C16H19F2NO2 — CID 43182373
N-[[4-(difluoromethoxy)phenyl]methyl]-4-(furan-2-yl)butan-2-amine (PubChem CID 43182373) has the molecular formula C16H19F2NO2 and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-4-(furan-2-yl)butan-2-amine.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-4-(furan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 43182373 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-4-(furan-2-yl)butan-2-amine |
| SMILES | CC(CCc1ccco1)NCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H19F2NO2/c1-12(4-7-14-3-2-10-20-14)19-11-13-5-8-15(9-6-13)21-16(17)18/h2-3,5-6,8-10,12,16,19H,4,7,11H2,1H3 |
| InChIKey | CXZDVXZVSMUWMM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |