C10H12N2O2S — CID 103266588
4-[(pent-3-ynylamino)methyl]-1,3-thiazole-2-carboxylic acid (PubChem CID 103266588) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 4-[(pent-3-ynylamino)methyl]-1,3-thiazole-2-carboxylic acid.
| Compound Name | 4-[(pent-3-ynylamino)methyl]-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 103266588 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-[(pent-3-ynylamino)methyl]-1,3-thiazole-2-carboxylic acid |
| SMILES | CC#CCCNCc1csc(C(=O)O)n1 |
| InChI | InChI=1S/C10H12N2O2S/c1-2-3-4-5-11-6-8-7-15-9(12-8)10(13)14/h7,11H,4-6H2,1H3,(H,13,14) |
| InChIKey | CVGLPZFRSJZARC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|