C17H18Cl3NO3 — CID 17209910
2-[4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]phenoxy]acetic acid;hydrochloride (PubChem CID 17209910) has the molecular formula C17H18Cl3NO3 and a molecular weight of 390.69 g/mol. Its IUPAC name is 2-[4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]phenoxy]acetic acid;hydrochloride.
| Compound Name | 2-[4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]phenoxy]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 17209910 |
| Molecular Formula | C17H18Cl3NO3 |
| Molecular Weight | 390.69 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-[4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]phenoxy]acetic acid;hydrochloride |
| SMILES | Cl.O=C(O)COc1ccc(CNCCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO3.ClH/c18-14-4-3-13(16(19)9-14)7-8-20-10-12-1-5-15(6-2-12)23-11-17(21)22;/h1-6,9,20H,7-8,10-11H2,(H,21,22);1H |
| InChIKey | GJDLHSATYZDXJM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.69 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|