C19H24Cl3NO — CID 17210398
N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride (PubChem CID 17210398) has the molecular formula C19H24Cl3NO and a molecular weight of 388.77 g/mol. Its IUPAC name is N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride.
| Compound Name | N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17210398 |
| Molecular Formula | C19H24Cl3NO |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)CCNCc1ccc(OCc2ccc(Cl)cc2Cl)cc1.Cl |
| InChI | InChI=1S/C19H23Cl2NO.ClH/c1-14(2)9-10-22-12-15-3-7-18(8-4-15)23-13-16-5-6-17(20)11-19(16)21;/h3-8,11,14,22H,9-10,12-13H2,1-2H3;1H |
| InChIKey | OPLPMLYPNIXBSU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|