C12H19Cl2N — CID 17206859
N-[(3-chlorophenyl)methyl]-3-methylbutan-1-amine;hydrochloride (PubChem CID 17206859) has the molecular formula C12H19Cl2N and a molecular weight of 248.20 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-methylbutan-1-amine;hydrochloride.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17206859 |
| Molecular Formula | C12H19Cl2N |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-methylbutan-1-amine;hydrochloride |
| SMILES | CC(C)CCNCc1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C12H18ClN.ClH/c1-10(2)6-7-14-9-11-4-3-5-12(13)8-11;/h3-5,8,10,14H,6-7,9H2,1-2H3;1H |
| InChIKey | CNEDPFQOEOMUMG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|