C12H19Cl2NO — CID 17293862
N-[(3-chlorophenyl)methyl]-3-ethoxypropan-1-amine;hydrochloride (PubChem CID 17293862) has the molecular formula C12H19Cl2NO and a molecular weight of 264.20 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-ethoxypropan-1-amine;hydrochloride.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-ethoxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17293862 |
| Molecular Formula | C12H19Cl2NO |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-ethoxypropan-1-amine;hydrochloride |
| SMILES | CCOCCCNCc1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C12H18ClNO.ClH/c1-2-15-8-4-7-14-10-11-5-3-6-12(13)9-11;/h3,5-6,9,14H,2,4,7-8,10H2,1H3;1H |
| InChIKey | IMAKSDMKTYRYAW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|