C16H26ClNO — CID 105086143
1-(3-chlorophenyl)-5-ethoxy-N-propylpentan-2-amine (PubChem CID 105086143) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-ethoxy-N-propylpentan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-5-ethoxy-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 105086143 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-(3-chlorophenyl)-5-ethoxy-N-propylpentan-2-amine |
| SMILES | CCCNC(CCCOCC)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H26ClNO/c1-3-10-18-16(9-6-11-19-4-2)13-14-7-5-8-15(17)12-14/h5,7-8,12,16,18H,3-4,6,9-11,13H2,1-2H3 |
| InChIKey | HOWMAJXWNWJLKV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|