C17H28ClN — CID 55187933
1-(3-chlorophenyl)-5,5-dimethyl-N-propylhexan-2-amine (PubChem CID 55187933) has the molecular formula C17H28ClN and a molecular weight of 281.87 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5,5-dimethyl-N-propylhexan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-5,5-dimethyl-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 55187933 |
| Molecular Formula | C17H28ClN |
| Molecular Weight | 281.87 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-(3-chlorophenyl)-5,5-dimethyl-N-propylhexan-2-amine |
| SMILES | CCCNC(CCC(C)(C)C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H28ClN/c1-5-11-19-16(9-10-17(2,3)4)13-14-7-6-8-15(18)12-14/h6-8,12,16,19H,5,9-11,13H2,1-4H3 |
| InChIKey | CYCLGBCYRZUSLN-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |