C16H26ClN — CID 63411991
1-(3-chlorophenyl)-4,4-dimethyl-N-propylpentan-1-amine (PubChem CID 63411991) has the molecular formula C16H26ClN and a molecular weight of 267.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4,4-dimethyl-N-propylpentan-1-amine.
| Compound Name | 1-(3-chlorophenyl)-4,4-dimethyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 63411991 |
| Molecular Formula | C16H26ClN |
| Molecular Weight | 267.84 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-(3-chlorophenyl)-4,4-dimethyl-N-propylpentan-1-amine |
| SMILES | CCCNC(CCC(C)(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H26ClN/c1-5-11-18-15(9-10-16(2,3)4)13-7-6-8-14(17)12-13/h6-8,12,15,18H,5,9-11H2,1-4H3 |
| InChIKey | XENVIQRNMTYPMV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.84 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |