C16H25Cl2N — CID 81492270
1-(3,4-dichlorophenyl)-4,4-dimethyl-N-propylpentan-1-amine (PubChem CID 81492270) has the molecular formula C16H25Cl2N and a molecular weight of 302.29 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4,4-dimethyl-N-propylpentan-1-amine.
| Compound Name | 1-(3,4-dichlorophenyl)-4,4-dimethyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 81492270 |
| Molecular Formula | C16H25Cl2N |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4,4-dimethyl-N-propylpentan-1-amine |
| SMILES | CCCNC(CCC(C)(C)C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H25Cl2N/c1-5-10-19-15(8-9-16(2,3)4)12-6-7-13(17)14(18)11-12/h6-7,11,15,19H,5,8-10H2,1-4H3 |
| InChIKey | VPTBRGCODBTWIZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |