C17H29NO — CID 63414142
1-(4-methoxyphenyl)-4,4-dimethyl-N-propylpentan-1-amine (PubChem CID 63414142) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4,4-dimethyl-N-propylpentan-1-amine.
| Compound Name | 1-(4-methoxyphenyl)-4,4-dimethyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 63414142 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-(4-methoxyphenyl)-4,4-dimethyl-N-propylpentan-1-amine |
| SMILES | CCCNC(CCC(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H29NO/c1-6-13-18-16(11-12-17(2,3)4)14-7-9-15(19-5)10-8-14/h7-10,16,18H,6,11-13H2,1-5H3 |
| InChIKey | GYMZFVCWXXWXHS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |