C13H17ClF3N — CID 64566182
1-(4-chlorophenyl)-4,4,4-trifluoro-N-propylbutan-1-amine (PubChem CID 64566182) has the molecular formula C13H17ClF3N and a molecular weight of 279.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4,4,4-trifluoro-N-propylbutan-1-amine.
| Compound Name | 1-(4-chlorophenyl)-4,4,4-trifluoro-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 64566182 |
| Molecular Formula | C13H17ClF3N |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(4-chlorophenyl)-4,4,4-trifluoro-N-propylbutan-1-amine |
| SMILES | CCCNC(CCC(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClF3N/c1-2-9-18-12(7-8-13(15,16)17)10-3-5-11(14)6-4-10/h3-6,12,18H,2,7-9H2,1H3 |
| InChIKey | ROOBGJNWOUHTRK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |