C14H20F3N — CID 64565776
4,4,4-trifluoro-1-(4-methylphenyl)-N-propylbutan-1-amine (PubChem CID 64565776) has the molecular formula C14H20F3N and a molecular weight of 259.31 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(4-methylphenyl)-N-propylbutan-1-amine.
| Compound Name | 4,4,4-trifluoro-1-(4-methylphenyl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 64565776 |
| Molecular Formula | C14H20F3N |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 4,4,4-trifluoro-1-(4-methylphenyl)-N-propylbutan-1-amine |
| SMILES | CCCNC(CCC(F)(F)F)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H20F3N/c1-3-10-18-13(8-9-14(15,16)17)12-6-4-11(2)5-7-12/h4-7,13,18H,3,8-10H2,1-2H3 |
| InChIKey | XXZQZXQHKUYLIE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |