C17H29N — CID 63412327
3-methyl-1-(4-methylphenyl)-N-propylhexan-1-amine (PubChem CID 63412327) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 3-methyl-1-(4-methylphenyl)-N-propylhexan-1-amine.
| Compound Name | 3-methyl-1-(4-methylphenyl)-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 63412327 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 3-methyl-1-(4-methylphenyl)-N-propylhexan-1-amine |
| SMILES | CCCNC(CC(C)CCC)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H29N/c1-5-7-15(4)13-17(18-12-6-2)16-10-8-14(3)9-11-16/h8-11,15,17-18H,5-7,12-13H2,1-4H3 |
| InChIKey | YUMKJSRITIUZKN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |