C12H14ClF4N — CID 79660522
1-(4-chlorophenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine (PubChem CID 79660522) has the molecular formula C12H14ClF4N and a molecular weight of 283.70 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine.
| Compound Name | 1-(4-chlorophenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 79660522 |
| Molecular Formula | C12H14ClF4N |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 1-(4-chlorophenyl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)cc1)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H14ClF4N/c1-2-7-18-10(12(16,17)11(14)15)8-3-5-9(13)6-4-8/h3-6,10-11,18H,2,7H2,1H3 |
| InChIKey | SQRTXSJZJSUBMI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|