C16H21F4N — CID 79644292
2,2,3,3-tetrafluoro-N-propyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propan-1-amine (PubChem CID 79644292) has the molecular formula C16H21F4N and a molecular weight of 303.34 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-propyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propan-1-amine.
| Compound Name | 2,2,3,3-tetrafluoro-N-propyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 79644292 |
| Molecular Formula | C16H21F4N |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-propyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)propan-1-amine |
| SMILES | CCCNC(c1ccc2c(c1)CCCC2)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H21F4N/c1-2-9-21-14(16(19,20)15(17)18)13-8-7-11-5-3-4-6-12(11)10-13/h7-8,10,14-15,21H,2-6,9H2,1H3 |
| InChIKey | BGUUIFWTXMHWNZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|