C12H17F4NO — CID 114249160
1-(4,5-dimethylfuran-2-yl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine (PubChem CID 114249160) has the molecular formula C12H17F4NO and a molecular weight of 267.27 g/mol. Its IUPAC name is 1-(4,5-dimethylfuran-2-yl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine.
| Compound Name | 1-(4,5-dimethylfuran-2-yl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 114249160 |
| Molecular Formula | C12H17F4NO |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 1-(4,5-dimethylfuran-2-yl)-2,2,3,3-tetrafluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cc(C)c(C)o1)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H17F4NO/c1-4-5-17-10(12(15,16)11(13)14)9-6-7(2)8(3)18-9/h6,10-11,17H,4-5H2,1-3H3 |
| InChIKey | VRHNUBWGMXAVOV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|