C19H31N — CID 43494268
N-propyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)hexan-1-amine (PubChem CID 43494268) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is N-propyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)hexan-1-amine.
| Compound Name | N-propyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)hexan-1-amine |
|---|---|
| PubChem CID | 43494268 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | N-propyl-1-(5,6,7,8-tetrahydronaphthalen-2-yl)hexan-1-amine |
| SMILES | CCCCCC(NCCC)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H31N/c1-3-5-6-11-19(20-14-4-2)18-13-12-16-9-7-8-10-17(16)15-18/h12-13,15,19-20H,3-11,14H2,1-2H3 |
| InChIKey | BTXVPCZGOPKVLM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|