C18H28O — CID 100938852
(3R)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)octan-3-ol (PubChem CID 100938852) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (3R)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)octan-3-ol.
| Compound Name | (3R)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)octan-3-ol |
|---|---|
| PubChem CID | 100938852 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (3R)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)octan-3-ol |
| SMILES | CCCCC[C@@H](O)C(C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H28O/c1-3-4-5-10-18(19)14(2)16-12-11-15-8-6-7-9-17(15)13-16/h11-14,18-19H,3-10H2,1-2H3/t14?,18-/m1/s1 |
| InChIKey | LLAJWJZMSKUXOY-XPKAQORNSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|