C20H30 — CID 58389477
3-(1-cyclohexylhexyl)bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 58389477) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 3-(1-cyclohexylhexyl)bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 3-(1-cyclohexylhexyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 58389477 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3-(1-cyclohexylhexyl)bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | CCCCCC(c1ccc2c(c1)CC2)C1CCCCC1 |
| InChI | InChI=1S/C20H30/c1-2-3-5-10-20(17-8-6-4-7-9-17)19-14-12-16-11-13-18(16)15-19/h12,14-15,17,20H,2-11,13H2,1H3 |
| InChIKey | ACWDJVHBAWIIMI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|