C19H28O — CID 65023370
cyclooctyl(5,6,7,8-tetrahydronaphthalen-2-yl)methanol (PubChem CID 65023370) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is cyclooctyl(5,6,7,8-tetrahydronaphthalen-2-yl)methanol.
| Compound Name | cyclooctyl(5,6,7,8-tetrahydronaphthalen-2-yl)methanol |
|---|---|
| PubChem CID | 65023370 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | cyclooctyl(5,6,7,8-tetrahydronaphthalen-2-yl)methanol |
| SMILES | OC(c1ccc2c(c1)CCCC2)C1CCCCCCC1 |
| InChI | InChI=1S/C19H28O/c20-19(16-9-4-2-1-3-5-10-16)18-13-12-15-8-6-7-11-17(15)14-18/h12-14,16,19-20H,1-11H2 |
| InChIKey | LSJZCDZYQYMWLH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |