C18H26O — CID 115806114
2,3-dihydro-1H-inden-5-yl-(3,4-dimethylcyclohexyl)methanol (PubChem CID 115806114) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl-(3,4-dimethylcyclohexyl)methanol.
| Compound Name | 2,3-dihydro-1H-inden-5-yl-(3,4-dimethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 115806114 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl-(3,4-dimethylcyclohexyl)methanol |
| SMILES | CC1CCC(C(O)c2ccc3c(c2)CCC3)CC1C |
| InChI | InChI=1S/C18H26O/c1-12-6-7-16(10-13(12)2)18(19)17-9-8-14-4-3-5-15(14)11-17/h8-9,11-13,16,18-19H,3-7,10H2,1-2H3 |
| InChIKey | BZXZZKCOPULHBF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |