C13H16F2O — CID 93184621
(S)-cyclohexyl-(3,4-difluorophenyl)methanol (PubChem CID 93184621) has the molecular formula C13H16F2O and a molecular weight of 226.27 g/mol. Its IUPAC name is (S)-cyclohexyl-(3,4-difluorophenyl)methanol.
| Compound Name | (S)-cyclohexyl-(3,4-difluorophenyl)methanol |
|---|---|
| PubChem CID | 93184621 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (S)-cyclohexyl-(3,4-difluorophenyl)methanol |
| SMILES | O[C@H](c1ccc(F)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C13H16F2O/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h6-9,13,16H,1-5H2/t13-/m0/s1 |
| InChIKey | GXZOYKZJWNCWCO-ZDUSSCGKSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |