C12H15F2NO — CID 43146486
(3,4-difluorophenyl)-piperidin-4-ylmethanol (PubChem CID 43146486) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is (3,4-difluorophenyl)-piperidin-4-ylmethanol.
| Compound Name | (3,4-difluorophenyl)-piperidin-4-ylmethanol |
|---|---|
| PubChem CID | 43146486 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (3,4-difluorophenyl)-piperidin-4-ylmethanol |
| SMILES | OC(c1ccc(F)c(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C12H15F2NO/c13-10-2-1-9(7-11(10)14)12(16)8-3-5-15-6-4-8/h1-2,7-8,12,15-16H,3-6H2 |
| InChIKey | KXMGXYGBOFEOFS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |