C11H13F2NO — CID 93183518
(R)-(3,4-difluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol (PubChem CID 93183518) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is (R)-(3,4-difluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol.
| Compound Name | (R)-(3,4-difluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 93183518 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | (R)-(3,4-difluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol |
| SMILES | O[C@H](c1ccc(F)c(F)c1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H13F2NO/c12-8-4-3-7(6-9(8)13)11(15)10-2-1-5-14-10/h3-4,6,10-11,14-15H,1-2,5H2/t10-,11+/m0/s1 |
| InChIKey | SRKNLOOZDMHLSC-WDEREUQCSA-N |
| XLogP | 1.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |