C11H12F3NO — CID 103303135
pyrrolidin-2-yl-(2,4,5-trifluorophenyl)methanol (PubChem CID 103303135) has the molecular formula C11H12F3NO and a molecular weight of 231.22 g/mol. Its IUPAC name is pyrrolidin-2-yl-(2,4,5-trifluorophenyl)methanol.
| Compound Name | pyrrolidin-2-yl-(2,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 103303135 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | pyrrolidin-2-yl-(2,4,5-trifluorophenyl)methanol |
| SMILES | OC(c1cc(F)c(F)cc1F)C1CCCN1 |
| InChI | InChI=1S/C11H12F3NO/c12-7-5-9(14)8(13)4-6(7)11(16)10-2-1-3-15-10/h4-5,10-11,15-16H,1-3H2 |
| InChIKey | JNILJHZHCSXOAI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|