C13H16F5NO — CID 142507550
ethane;(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-2-ylmethanol (PubChem CID 142507550) has the molecular formula C13H16F5NO and a molecular weight of 297.27 g/mol. Its IUPAC name is ethane;(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-2-ylmethanol.
| Compound Name | ethane;(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-2-ylmethanol |
|---|---|
| PubChem CID | 142507550 |
| Molecular Formula | C13H16F5NO |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | ethane;(2,3,4,5,6-pentafluorophenyl)-pyrrolidin-2-ylmethanol |
| SMILES | CC.OC(c1c(F)c(F)c(F)c(F)c1F)C1CCCN1 |
| InChI | InChI=1S/C11H10F5NO.C2H6/c12-6-5(11(18)4-2-1-3-17-4)7(13)9(15)10(16)8(6)14;1-2/h4,11,17-18H,1-3H2;1-2H3 |
| InChIKey | CUKKDKOCLJXSNC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|