C27H43FN2O2 — CID 155698677
ethane;(3-fluorophenyl)-pyrrolidin-2-ylmethanol;(4-methylphenyl)-pyrrolidin-2-ylmethanol (PubChem CID 155698677) has the molecular formula C27H43FN2O2 and a molecular weight of 446.65 g/mol. Its IUPAC name is ethane;(3-fluorophenyl)-pyrrolidin-2-ylmethanol;(4-methylphenyl)-pyrrolidin-2-ylmethanol.
| Compound Name | ethane;(3-fluorophenyl)-pyrrolidin-2-ylmethanol;(4-methylphenyl)-pyrrolidin-2-ylmethanol |
|---|---|
| PubChem CID | 155698677 |
| Molecular Formula | C27H43FN2O2 |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | ethane;(3-fluorophenyl)-pyrrolidin-2-ylmethanol;(4-methylphenyl)-pyrrolidin-2-ylmethanol |
| SMILES | CC.CC.Cc1ccc(C(O)C2CCCN2)cc1.OC(c1cccc(F)c1)C1CCCN1 |
| InChI | InChI=1S/C12H17NO.C11H14FNO.2C2H6/c1-9-4-6-10(7-5-9)12(14)11-3-2-8-13-11;12-9-4-1-3-8(7-9)11(14)10-5-2-6-13-10;2*1-2/h4-7,11-14H,2-3,8H2,1H3;1,3-4,7,10-11,13-14H,2,5-6H2;2*1-2H3 |
| InChIKey | DRUILLUVMQNTPW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |