C12H16FNO — CID 155134327
(4,4-dimethylazetidin-2-yl)-(3-fluorophenyl)methanol (PubChem CID 155134327) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is (4,4-dimethylazetidin-2-yl)-(3-fluorophenyl)methanol.
| Compound Name | (4,4-dimethylazetidin-2-yl)-(3-fluorophenyl)methanol |
|---|---|
| PubChem CID | 155134327 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (4,4-dimethylazetidin-2-yl)-(3-fluorophenyl)methanol |
| SMILES | CC1(C)CC(C(O)c2cccc(F)c2)N1 |
| InChI | InChI=1S/C12H16FNO/c1-12(2)7-10(14-12)11(15)8-4-3-5-9(13)6-8/h3-6,10-11,14-15H,7H2,1-2H3 |
| InChIKey | YLPFUXCNJIAORL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |