C16H20ClNO5 — CID 155127072
(Z)-but-2-enedioic acid;(S)-(3-chlorophenyl)-(4,4-dimethylazetidin-2-yl)methanol (PubChem CID 155127072) has the molecular formula C16H20ClNO5 and a molecular weight of 341.79 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;(S)-(3-chlorophenyl)-(4,4-dimethylazetidin-2-yl)methanol.
| Compound Name | (Z)-but-2-enedioic acid;(S)-(3-chlorophenyl)-(4,4-dimethylazetidin-2-yl)methanol |
|---|---|
| PubChem CID | 155127072 |
| Molecular Formula | C16H20ClNO5 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (Z)-but-2-enedioic acid;(S)-(3-chlorophenyl)-(4,4-dimethylazetidin-2-yl)methanol |
| SMILES | CC1(C)CC([C@@H](O)c2cccc(Cl)c2)N1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H16ClNO.C4H4O4/c1-12(2)7-10(14-12)11(15)8-4-3-5-9(13)6-8;5-3(6)1-2-4(7)8/h3-6,10-11,14-15H,7H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t10?,11-;/m0./s1 |
| InChIKey | MEXHJKVTGOQPQM-PGRWWKEESA-N |
| XLogP | 2.23 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|