C28H32Cl2N2O4 — CID 155127069
bis[(S)-(3-chlorophenyl)-[(2R)-4,4-dimethylazetidin-2-yl]methyl] (Z)-but-2-enedioate (PubChem CID 155127069) has the molecular formula C28H32Cl2N2O4 and a molecular weight of 531.48 g/mol. Its IUPAC name is bis[(S)-(3-chlorophenyl)-[(2R)-4,4-dimethylazetidin-2-yl]methyl] (Z)-but-2-enedioate.
| Compound Name | bis[(S)-(3-chlorophenyl)-[(2R)-4,4-dimethylazetidin-2-yl]methyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 155127069 |
| Molecular Formula | C28H32Cl2N2O4 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | bis[(S)-(3-chlorophenyl)-[(2R)-4,4-dimethylazetidin-2-yl]methyl] (Z)-but-2-enedioate |
| SMILES | CC1(C)C[C@H]([C@@H](OC(=O)/C=C\C(=O)O[C@@H](c2cccc(Cl)c2)[C@H]2CC(C)(C)N2)c2cccc(Cl)c2)N1 |
| InChI | InChI=1S/C28H32Cl2N2O4/c1-27(2)15-21(31-27)25(17-7-5-9-19(29)13-17)35-23(33)11-12-24(34)36-26(22-16-28(3,4)32-22)18-8-6-10-20(30)14-18/h5-14,21-22,25-26,31-32H,15-16H2,1-4H3/b12-11-/t21-,22-,25+,26+/m1/s1 |
| InChIKey | NHWQNLAEPYAIGG-VTHJCVBVSA-N |
| XLogP | 5.70 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|