C12H16ClNO — CID 155126922
(R)-(3-chlorophenyl)-[(2R)-4,4-dimethylazetidin-2-yl]methanol (PubChem CID 155126922) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is (R)-(3-chlorophenyl)-[(2R)-4,4-dimethylazetidin-2-yl]methanol.
| Compound Name | (R)-(3-chlorophenyl)-[(2R)-4,4-dimethylazetidin-2-yl]methanol |
|---|---|
| PubChem CID | 155126922 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (R)-(3-chlorophenyl)-[(2R)-4,4-dimethylazetidin-2-yl]methanol |
| SMILES | CC1(C)C[C@H]([C@H](O)c2cccc(Cl)c2)N1 |
| InChI | InChI=1S/C12H16ClNO/c1-12(2)7-10(14-12)11(15)8-4-3-5-9(13)6-8/h3-6,10-11,14-15H,7H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | BMPRLBYLHQVOOH-GHMZBOCLSA-N |
| XLogP | 2.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |