C14H19Cl2NO — CID 163219221
(S)-(3-chlorophenyl)-(4-methyl-7-azabicyclo[2.2.1]heptan-1-yl)methanol;hydrochloride (PubChem CID 163219221) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is (S)-(3-chlorophenyl)-(4-methyl-7-azabicyclo[2.2.1]heptan-1-yl)methanol;hydrochloride.
| Compound Name | (S)-(3-chlorophenyl)-(4-methyl-7-azabicyclo[2.2.1]heptan-1-yl)methanol;hydrochloride |
|---|---|
| PubChem CID | 163219221 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (S)-(3-chlorophenyl)-(4-methyl-7-azabicyclo[2.2.1]heptan-1-yl)methanol;hydrochloride |
| SMILES | CC12CCC([C@@H](O)c3cccc(Cl)c3)(CC1)N2.Cl |
| InChI | InChI=1S/C14H18ClNO.ClH/c1-13-5-7-14(16-13,8-6-13)12(17)10-3-2-4-11(15)9-10;/h2-4,9,12,16-17H,5-8H2,1H3;1H/t12-,13?,14?;/m0./s1 |
| InChIKey | KWPYTTXBNLFUEH-NEWLCSRUSA-N |
| XLogP | 3.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |