C13H13ClN2O4 — CID 76905495
4-[1-(3-chlorophenyl)ethylcarbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 76905495) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is 4-[1-(3-chlorophenyl)ethylcarbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[1-(3-chlorophenyl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76905495 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-[1-(3-chlorophenyl)ethylcarbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(NC(=O)NC(=O)C=CC(=O)O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H13ClN2O4/c1-8(9-3-2-4-10(14)7-9)15-13(20)16-11(17)5-6-12(18)19/h2-8H,1H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | BVLWLYGZUSSKKU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|