C11H12ClF3N2O — CID 47134201
1-[1-(3-chlorophenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 47134201) has the molecular formula C11H12ClF3N2O and a molecular weight of 280.68 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[1-(3-chlorophenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 47134201 |
| Molecular Formula | C11H12ClF3N2O |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(NC(=O)NCC(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H12ClF3N2O/c1-7(8-3-2-4-9(12)5-8)17-10(18)16-6-11(13,14)15/h2-5,7H,6H2,1H3,(H2,16,17,18) |
| InChIKey | CCLJPKWBZRKXMJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |