C15H10ClF5N2O — CID 51944325
1-[(1R)-1-(3-chlorophenyl)ethyl]-3-(2,3,4,5,6-pentafluorophenyl)urea (PubChem CID 51944325) has the molecular formula C15H10ClF5N2O and a molecular weight of 364.70 g/mol. Its IUPAC name is 1-[(1R)-1-(3-chlorophenyl)ethyl]-3-(2,3,4,5,6-pentafluorophenyl)urea.
| Compound Name | 1-[(1R)-1-(3-chlorophenyl)ethyl]-3-(2,3,4,5,6-pentafluorophenyl)urea |
|---|---|
| PubChem CID | 51944325 |
| Molecular Formula | C15H10ClF5N2O |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-[(1R)-1-(3-chlorophenyl)ethyl]-3-(2,3,4,5,6-pentafluorophenyl)urea |
| SMILES | C[C@@H](NC(=O)Nc1c(F)c(F)c(F)c(F)c1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H10ClF5N2O/c1-6(7-3-2-4-8(16)5-7)22-15(24)23-14-12(20)10(18)9(17)11(19)13(14)21/h2-6H,1H3,(H2,22,23,24)/t6-/m1/s1 |
| InChIKey | FHUILMHLRRCJAQ-ZCFIWIBFSA-N |
| XLogP | 4.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|