C16H16ClFN2O — CID 51945133
1-[(1S)-1-(3-chlorophenyl)ethyl]-3-(4-fluoro-2-methylphenyl)urea (PubChem CID 51945133) has the molecular formula C16H16ClFN2O and a molecular weight of 306.77 g/mol. Its IUPAC name is 1-[(1S)-1-(3-chlorophenyl)ethyl]-3-(4-fluoro-2-methylphenyl)urea.
| Compound Name | 1-[(1S)-1-(3-chlorophenyl)ethyl]-3-(4-fluoro-2-methylphenyl)urea |
|---|---|
| PubChem CID | 51945133 |
| Molecular Formula | C16H16ClFN2O |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-[(1S)-1-(3-chlorophenyl)ethyl]-3-(4-fluoro-2-methylphenyl)urea |
| SMILES | Cc1cc(F)ccc1NC(=O)N[C@@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClFN2O/c1-10-8-14(18)6-7-15(10)20-16(21)19-11(2)12-4-3-5-13(17)9-12/h3-9,11H,1-2H3,(H2,19,20,21)/t11-/m0/s1 |
| InChIKey | BPHGFIJKDWUULA-NSHDSACASA-N |
| XLogP | 4.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |