C16H15ClF2N2O3S — CID 47032730
1-[1-(3-chlorophenyl)ethyl]-3-[4-(difluoromethylsulfonyl)phenyl]urea (PubChem CID 47032730) has the molecular formula C16H15ClF2N2O3S and a molecular weight of 388.82 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethyl]-3-[4-(difluoromethylsulfonyl)phenyl]urea.
| Compound Name | 1-[1-(3-chlorophenyl)ethyl]-3-[4-(difluoromethylsulfonyl)phenyl]urea |
|---|---|
| PubChem CID | 47032730 |
| Molecular Formula | C16H15ClF2N2O3S |
| Molecular Weight | 388.82 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethyl]-3-[4-(difluoromethylsulfonyl)phenyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(S(=O)(=O)C(F)F)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClF2N2O3S/c1-10(11-3-2-4-12(17)9-11)20-16(22)21-13-5-7-14(8-6-13)25(23,24)15(18)19/h2-10,15H,1H3,(H2,20,21,22) |
| InChIKey | GZMIJUHQVRCRCU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.82 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |