C16H11ClF5NOS — CID 7467431
N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide (PubChem CID 7467431) has the molecular formula C16H11ClF5NOS and a molecular weight of 395.78 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7467431 |
| Molecular Formula | C16H11ClF5NOS |
| Molecular Weight | 395.78 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(2,3,4,5,6-pentafluorophenyl)sulfanylacetamide |
| SMILES | C[C@H](NC(=O)CSc1c(F)c(F)c(F)c(F)c1F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H11ClF5NOS/c1-7(8-3-2-4-9(17)5-8)23-10(24)6-25-16-14(21)12(19)11(18)13(20)15(16)22/h2-5,7H,6H2,1H3,(H,23,24)/t7-/m0/s1 |
| InChIKey | FZULOJRZFAAIBC-ZETCQYMHSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.78 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|