C14H16ClN3OS — CID 40529502
N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide (PubChem CID 40529502) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 40529502 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide |
| SMILES | C[C@H](NC(=O)CSc1nccn1C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16ClN3OS/c1-10(11-4-3-5-12(15)8-11)17-13(19)9-20-14-16-6-7-18(14)2/h3-8,10H,9H2,1-2H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | OLRJRKYEJGZVGU-JTQLQIEISA-N |
| XLogP | 3.04 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |