C10H17N3OS — CID 28699058
N-[(2R)-butan-2-yl]-2-(1-methylimidazol-2-yl)sulfanylacetamide (PubChem CID 28699058) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-(1-methylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-(1-methylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 28699058 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-(1-methylimidazol-2-yl)sulfanylacetamide |
| SMILES | CC[C@@H](C)NC(=O)CSc1nccn1C |
| InChI | InChI=1S/C10H17N3OS/c1-4-8(2)12-9(14)7-15-10-11-5-6-13(10)3/h5-6,8H,4,7H2,1-3H3,(H,12,14)/t8-/m1/s1 |
| InChIKey | NCKCPBRRWKDTMQ-MRVPVSSYSA-N |
| XLogP | 1.43 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |