C11H16N2OS — CID 94102095
N-[(2S)-butan-2-yl]-2-pyridin-4-ylsulfanylacetamide (PubChem CID 94102095) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-pyridin-4-ylsulfanylacetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-pyridin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 94102095 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-pyridin-4-ylsulfanylacetamide |
| SMILES | CC[C@H](C)NC(=O)CSc1ccncc1 |
| InChI | InChI=1S/C11H16N2OS/c1-3-9(2)13-11(14)8-15-10-4-6-12-7-5-10/h4-7,9H,3,8H2,1-2H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | YBMJJPHSUSNXAG-VIFPVBQESA-N |
| XLogP | 2.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |