C12H20ClN3OS — CID 120650682
N-[(2R)-2-(ethylamino)propyl]-2-pyridin-4-ylsulfanylacetamide;hydrochloride (PubChem CID 120650682) has the molecular formula C12H20ClN3OS and a molecular weight of 289.83 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-2-pyridin-4-ylsulfanylacetamide;hydrochloride.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-2-pyridin-4-ylsulfanylacetamide;hydrochloride |
|---|---|
| PubChem CID | 120650682 |
| Molecular Formula | C12H20ClN3OS |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-2-pyridin-4-ylsulfanylacetamide;hydrochloride |
| SMILES | CCN[C@H](C)CNC(=O)CSc1ccncc1.Cl |
| InChI | InChI=1S/C12H19N3OS.ClH/c1-3-14-10(2)8-15-12(16)9-17-11-4-6-13-7-5-11;/h4-7,10,14H,3,8-9H2,1-2H3,(H,15,16);1H/t10-;/m1./s1 |
| InChIKey | VPJAXKJSCRZMGC-HNCPQSOCSA-N |
| XLogP | 1.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |