C14H20N2O3S — CID 81004061
tert-butyl (2R)-2-[(2-pyridin-4-ylsulfanylacetyl)amino]propanoate (PubChem CID 81004061) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-pyridin-4-ylsulfanylacetyl)amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[(2-pyridin-4-ylsulfanylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 81004061 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | tert-butyl (2R)-2-[(2-pyridin-4-ylsulfanylacetyl)amino]propanoate |
| SMILES | C[C@@H](NC(=O)CSc1ccncc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H20N2O3S/c1-10(13(18)19-14(2,3)4)16-12(17)9-20-11-5-7-15-8-6-11/h5-8,10H,9H2,1-4H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | KLBMIIBOBWPQFH-SNVBAGLBSA-N |
| XLogP | 2.02 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |