C15H23ClN2O2 — CID 110909987
1-[1-(3-chlorophenyl)ethyl]-3-(2-hydroxy-4-methylpentyl)urea (PubChem CID 110909987) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)ethyl]-3-(2-hydroxy-4-methylpentyl)urea.
| Compound Name | 1-[1-(3-chlorophenyl)ethyl]-3-(2-hydroxy-4-methylpentyl)urea |
|---|---|
| PubChem CID | 110909987 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[1-(3-chlorophenyl)ethyl]-3-(2-hydroxy-4-methylpentyl)urea |
| SMILES | CC(C)CC(O)CNC(=O)NC(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2O2/c1-10(2)7-14(19)9-17-15(20)18-11(3)12-5-4-6-13(16)8-12/h4-6,8,10-11,14,19H,7,9H2,1-3H3,(H2,17,18,20) |
| InChIKey | CIWSRYFVEKBHJA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |