C13H17ClFNO — CID 163219241
(S)-(3-fluorophenyl)-[(3S)-1-methyl-2-azabicyclo[2.1.1]hexan-3-yl]methanol;hydrochloride (PubChem CID 163219241) has the molecular formula C13H17ClFNO and a molecular weight of 257.74 g/mol. Its IUPAC name is (S)-(3-fluorophenyl)-[(3S)-1-methyl-2-azabicyclo[2.1.1]hexan-3-yl]methanol;hydrochloride.
| Compound Name | (S)-(3-fluorophenyl)-[(3S)-1-methyl-2-azabicyclo[2.1.1]hexan-3-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 163219241 |
| Molecular Formula | C13H17ClFNO |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (S)-(3-fluorophenyl)-[(3S)-1-methyl-2-azabicyclo[2.1.1]hexan-3-yl]methanol;hydrochloride |
| SMILES | CC12CC(C1)[C@@H]([C@@H](O)c1cccc(F)c1)N2.Cl |
| InChI | InChI=1S/C13H16FNO.ClH/c1-13-6-9(7-13)11(15-13)12(16)8-3-2-4-10(14)5-8;/h2-5,9,11-12,15-16H,6-7H2,1H3;1H/t9?,11-,12-,13?;/m0./s1 |
| InChIKey | RCGAZMWFMXKOSW-ROAKWDAVSA-N |
| XLogP | 2.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |