C14H17FO — CID 165040005
(S)-(3-fluorophenyl)-[(6S)-spiro[2.4]heptan-6-yl]methanol (PubChem CID 165040005) has the molecular formula C14H17FO and a molecular weight of 220.29 g/mol. Its IUPAC name is (S)-(3-fluorophenyl)-[(6S)-spiro[2.4]heptan-6-yl]methanol.
| Compound Name | (S)-(3-fluorophenyl)-[(6S)-spiro[2.4]heptan-6-yl]methanol |
|---|---|
| PubChem CID | 165040005 |
| Molecular Formula | C14H17FO |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (S)-(3-fluorophenyl)-[(6S)-spiro[2.4]heptan-6-yl]methanol |
| SMILES | O[C@H](c1cccc(F)c1)[C@H]1CCC2(CC2)C1 |
| InChI | InChI=1S/C14H17FO/c15-12-3-1-2-10(8-12)13(16)11-4-5-14(9-11)6-7-14/h1-3,8,11,13,16H,4-7,9H2/t11-,13+/m0/s1 |
| InChIKey | NYWGICVDVAGGLU-WCQYABFASA-N |
| XLogP | 3.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |