C17H25FO — CID 114978561
(4-butylcyclohexyl)-(3-fluorophenyl)methanol (PubChem CID 114978561) has the molecular formula C17H25FO and a molecular weight of 264.38 g/mol. Its IUPAC name is (4-butylcyclohexyl)-(3-fluorophenyl)methanol.
| Compound Name | (4-butylcyclohexyl)-(3-fluorophenyl)methanol |
|---|---|
| PubChem CID | 114978561 |
| Molecular Formula | C17H25FO |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (4-butylcyclohexyl)-(3-fluorophenyl)methanol |
| SMILES | CCCCC1CCC(C(O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C17H25FO/c1-2-3-5-13-8-10-14(11-9-13)17(19)15-6-4-7-16(18)12-15/h4,6-7,12-14,17,19H,2-3,5,8-11H2,1H3 |
| InChIKey | WYJNYEPBDLKXPC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |