C20H29FN2O2 — CID 56569745
N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-4-butyl-N-methylcyclohexane-1-carboxamide (PubChem CID 56569745) has the molecular formula C20H29FN2O2 and a molecular weight of 348.46 g/mol. Its IUPAC name is N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-4-butyl-N-methylcyclohexane-1-carboxamide.
| Compound Name | N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-4-butyl-N-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 56569745 |
| Molecular Formula | C20H29FN2O2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-[2-amino-1-(3-fluorophenyl)-2-oxoethyl]-4-butyl-N-methylcyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)N(C)C(C(N)=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H29FN2O2/c1-3-4-6-14-9-11-15(12-10-14)20(25)23(2)18(19(22)24)16-7-5-8-17(21)13-16/h5,7-8,13-15,18H,3-4,6,9-12H2,1-2H3,(H2,22,24) |
| InChIKey | UFWLWPTWCUDQKX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |