C34H55NO3 — CID 90335881
[(1R,2S)-2-[methyl-(4-pentylcyclohexanecarbonyl)amino]-1-phenylpropyl] 4-pentylcyclohexane-1-carboxylate (PubChem CID 90335881) has the molecular formula C34H55NO3 and a molecular weight of 525.82 g/mol. Its IUPAC name is [(1R,2S)-2-[methyl-(4-pentylcyclohexanecarbonyl)amino]-1-phenylpropyl] 4-pentylcyclohexane-1-carboxylate.
| Compound Name | [(1R,2S)-2-[methyl-(4-pentylcyclohexanecarbonyl)amino]-1-phenylpropyl] 4-pentylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90335881 |
| Molecular Formula | C34H55NO3 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 525.42 |
| IUPAC Name | [(1R,2S)-2-[methyl-(4-pentylcyclohexanecarbonyl)amino]-1-phenylpropyl] 4-pentylcyclohexane-1-carboxylate |
| SMILES | CCCCCC1CCC(C(=O)O[C@H](c2ccccc2)[C@H](C)N(C)C(=O)C2CCC(CCCCC)CC2)CC1 |
| InChI | InChI=1S/C34H55NO3/c1-5-7-10-14-27-18-22-30(23-19-27)33(36)35(4)26(3)32(29-16-12-9-13-17-29)38-34(37)31-24-20-28(21-25-31)15-11-8-6-2/h9,12-13,16-17,26-28,30-32H,5-8,10-11,14-15,18-25H2,1-4H3/t26-,27?,28?,30?,31?,32-/m0/s1 |
| InChIKey | STMTVUAVVWFSMR-CCLWNHJASA-N |
| XLogP | 8.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|